C25H22N2O5S2 — CID 46350845
[3-amino-5-(3-methoxyanilino)-4-(4-methoxyphenyl)sulfonylthiophen-2-yl]-phenylmethanone (PubChem CID 46350845) has the molecular formula C25H22N2O5S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is [3-amino-5-(3-methoxyanilino)-4-(4-methoxyphenyl)sulfonylthiophen-2-yl]-phenylmethanone.
| Compound Name | [3-amino-5-(3-methoxyanilino)-4-(4-methoxyphenyl)sulfonylthiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 46350845 |
| Molecular Formula | C25H22N2O5S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [3-amino-5-(3-methoxyanilino)-4-(4-methoxyphenyl)sulfonylthiophen-2-yl]-phenylmethanone |
| SMILES | COc1ccc(S(=O)(=O)c2c(Nc3cccc(OC)c3)sc(C(=O)c3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C25H22N2O5S2/c1-31-18-11-13-20(14-12-18)34(29,30)24-21(26)23(22(28)16-7-4-3-5-8-16)33-25(24)27-17-9-6-10-19(15-17)32-2/h3-15,27H,26H2,1-2H3 |
| InChIKey | OWSKUDLIFBQKJT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |