C18H13BrCl2N2O4 — CID 46352168
[2-[3-acetyl-5-(4-bromophenyl)-2H-1,3,4-oxadiazol-2-yl]-4,6-dichlorophenyl] acetate (PubChem CID 46352168) has the molecular formula C18H13BrCl2N2O4 and a molecular weight of 472.12 g/mol. Its IUPAC name is [2-[3-acetyl-5-(4-bromophenyl)-2H-1,3,4-oxadiazol-2-yl]-4,6-dichlorophenyl] acetate.
| Compound Name | [2-[3-acetyl-5-(4-bromophenyl)-2H-1,3,4-oxadiazol-2-yl]-4,6-dichlorophenyl] acetate |
|---|---|
| PubChem CID | 46352168 |
| Molecular Formula | C18H13BrCl2N2O4 |
| Molecular Weight | 472.12 g/mol |
| Exact Mass | 469.94 |
| IUPAC Name | [2-[3-acetyl-5-(4-bromophenyl)-2H-1,3,4-oxadiazol-2-yl]-4,6-dichlorophenyl] acetate |
| SMILES | CC(=O)Oc1c(Cl)cc(Cl)cc1C1OC(c2ccc(Br)cc2)=NN1C(C)=O |
| InChI | InChI=1S/C18H13BrCl2N2O4/c1-9(24)23-18(27-17(22-23)11-3-5-12(19)6-4-11)14-7-13(20)8-15(21)16(14)26-10(2)25/h3-8,18H,1-2H3 |
| InChIKey | YKDCJFNZJBIMTN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.12 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|