C18H15N3O6 — CID 46352223
[2-(3-acetyl-2-phenyl-2H-1,3,4-oxadiazol-5-yl)-4-nitrophenyl] acetate (PubChem CID 46352223) has the molecular formula C18H15N3O6 and a molecular weight of 369.33 g/mol. Its IUPAC name is [2-(3-acetyl-2-phenyl-2H-1,3,4-oxadiazol-5-yl)-4-nitrophenyl] acetate.
| Compound Name | [2-(3-acetyl-2-phenyl-2H-1,3,4-oxadiazol-5-yl)-4-nitrophenyl] acetate |
|---|---|
| PubChem CID | 46352223 |
| Molecular Formula | C18H15N3O6 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-(3-acetyl-2-phenyl-2H-1,3,4-oxadiazol-5-yl)-4-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1ccc([N+](=O)[O-])cc1C1=NN(C(C)=O)C(c2ccccc2)O1 |
| InChI | InChI=1S/C18H15N3O6/c1-11(22)20-18(13-6-4-3-5-7-13)27-17(19-20)15-10-14(21(24)25)8-9-16(15)26-12(2)23/h3-10,18H,1-2H3 |
| InChIKey | RQCASPUXGLVODO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|