C23H17ClN4O5 — CID 46352364
N-[3-[3-acetyl-5-(4-nitrophenyl)-2H-1,3,4-oxadiazol-2-yl]phenyl]-3-chlorobenzamide (PubChem CID 46352364) has the molecular formula C23H17ClN4O5 and a molecular weight of 464.87 g/mol. Its IUPAC name is N-[3-[3-acetyl-5-(4-nitrophenyl)-2H-1,3,4-oxadiazol-2-yl]phenyl]-3-chlorobenzamide.
| Compound Name | N-[3-[3-acetyl-5-(4-nitrophenyl)-2H-1,3,4-oxadiazol-2-yl]phenyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 46352364 |
| Molecular Formula | C23H17ClN4O5 |
| Molecular Weight | 464.87 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[3-[3-acetyl-5-(4-nitrophenyl)-2H-1,3,4-oxadiazol-2-yl]phenyl]-3-chlorobenzamide |
| SMILES | CC(=O)N1N=C(c2ccc([N+](=O)[O-])cc2)OC1c1cccc(NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H17ClN4O5/c1-14(29)27-23(33-22(26-27)15-8-10-20(11-9-15)28(31)32)17-5-3-7-19(13-17)25-21(30)16-4-2-6-18(24)12-16/h2-13,23H,1H3,(H,25,30) |
| InChIKey | UBTTZVGDGYDJDL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|