C22H25N3O — CID 46353130
7-methyl-3-[(2,4,6-trimethylphenyl)methyl]-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-4-one (PubChem CID 46353130) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 7-methyl-3-[(2,4,6-trimethylphenyl)methyl]-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-4-one.
| Compound Name | 7-methyl-3-[(2,4,6-trimethylphenyl)methyl]-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-4-one |
|---|---|
| PubChem CID | 46353130 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 7-methyl-3-[(2,4,6-trimethylphenyl)methyl]-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-4-one |
| SMILES | Cc1cc(C)c(Cn2cnc3nc4c(cc3c2=O)CC(C)CC4)c(C)c1 |
| InChI | InChI=1S/C22H25N3O/c1-13-5-6-20-17(9-13)10-18-21(24-20)23-12-25(22(18)26)11-19-15(3)7-14(2)8-16(19)4/h7-8,10,12-13H,5-6,9,11H2,1-4H3 |
| InChIKey | RKHOKWOSYITWFI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |