About N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide
N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 46353486) has the molecular formula C13H19N3O2S2
and a molecular weight of 313.45 g/mol. Its IUPAC name is N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide |
| PubChem CID | 46353486 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1CCN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-10-12(11(2)16(4)14-10)7-8-15(3)20(17,18)13-6-5-9-19-13/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | CEVRWLPQSSHTPD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide?
The IUPAC name of N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide (CID 46353486) is N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide.
What is the SMILES notation for N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide?
The canonical SMILES for N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide is Cc1nn(C)c(C)c1CCN(C)S(=O)(=O)c1cccs1.
What is the InChIKey of N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide?
The InChIKey is CEVRWLPQSSHTPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2S2/c1-10-12(11(2)16(4)14-10)7-8-15(3)20(17,18)13-6-5-9-19-13/h5-6,9H,7-8H2,1-4H3.
What are the key properties of N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide?
N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide has a molecular weight of 313.45 g/mol, XLogP of 1.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide is sourced from PubChem (CID 46353486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).