C25H26BrNO7 — CID 4635531
4-[(4-bromophenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4635531) has the molecular formula C25H26BrNO7 and a molecular weight of 532.39 g/mol. Its IUPAC name is 4-[(4-bromophenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-bromophenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4635531 |
| Molecular Formula | C25H26BrNO7 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 4-[(4-bromophenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccc(Br)cc3)C(=O)C(=O)N2CC2CCCO2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26BrNO7/c1-31-18-11-15(12-19(32-2)24(18)33-3)21-20(22(28)14-6-8-16(26)9-7-14)23(29)25(30)27(21)13-17-5-4-10-34-17/h6-9,11-12,17,21,28H,4-5,10,13H2,1-3H3 |
| InChIKey | DQUADKPRDWBLKV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|