C17H19N3O4S — CID 46355362
4-(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)-N-(2-methoxyethyl)benzamide (PubChem CID 46355362) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is 4-(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 46355362 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-(1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(C2Nc3ccccc3S(=O)(=O)N2)cc1 |
| InChI | InChI=1S/C17H19N3O4S/c1-24-11-10-18-17(21)13-8-6-12(7-9-13)16-19-14-4-2-3-5-15(14)25(22,23)20-16/h2-9,16,19-20H,10-11H2,1H3,(H,18,21) |
| InChIKey | SWFNCHPYCIDTQS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|