About N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide
N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide (PubChem CID 46355371) has the molecular formula C18H16FN3O2
and a molecular weight of 325.34 g/mol. Its IUPAC name is N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide.
Molecular Properties
| Compound Name | N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide |
| PubChem CID | 46355371 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide |
| SMILES | Cc1nc2c(C)cccn2c(=O)c1NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN3O2/c1-11-4-3-9-22-17(11)20-12(2)16(18(22)24)21-15(23)10-13-5-7-14(19)8-6-13/h3-9H,10H2,1-2H3,(H,21,23) |
| InChIKey | PRADCDFXFQHCSF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide?
The IUPAC name of N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide (CID 46355371) is N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide.
What is the SMILES notation for N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide?
The canonical SMILES for N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide is Cc1nc2c(C)cccn2c(=O)c1NC(=O)Cc1ccc(F)cc1.
What is the InChIKey of N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide?
The InChIKey is PRADCDFXFQHCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O2/c1-11-4-3-9-22-17(11)20-12(2)16(18(22)24)21-15(23)10-13-5-7-14(19)8-6-13/h3-9H,10H2,1-2H3,(H,21,23).
What are the key properties of N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide?
N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide has a molecular weight of 325.34 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,9-dimethyl-4-oxopyrido[1,2-a]pyrimidin-3-yl)-2-(4-fluorophenyl)acetamide is sourced from PubChem (CID 46355371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).