About N-benzyl-N,3-dimethylbutanamide
N-benzyl-N,3-dimethylbutanamide (PubChem CID 4635592) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is N-benzyl-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-benzyl-N,3-dimethylbutanamide |
| PubChem CID | 4635592 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-benzyl-N,3-dimethylbutanamide |
| SMILES | CC(C)CC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-11(2)9-13(15)14(3)10-12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3 |
| InChIKey | KSBUVPSHIODYKG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N,3-dimethylbutanamide?
The IUPAC name of N-benzyl-N,3-dimethylbutanamide (CID 4635592) is N-benzyl-N,3-dimethylbutanamide.
What is the SMILES notation for N-benzyl-N,3-dimethylbutanamide?
The canonical SMILES for N-benzyl-N,3-dimethylbutanamide is CC(C)CC(=O)N(C)Cc1ccccc1.
What is the InChIKey of N-benzyl-N,3-dimethylbutanamide?
The InChIKey is KSBUVPSHIODYKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-11(2)9-13(15)14(3)10-12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3.
What are the key properties of N-benzyl-N,3-dimethylbutanamide?
N-benzyl-N,3-dimethylbutanamide has a molecular weight of 205.30 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N,3-dimethylbutanamide is sourced from PubChem (CID 4635592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).