C22H17N3O3 — CID 46355928
N-[4-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]benzamide (PubChem CID 46355928) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[4-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]benzamide.
| Compound Name | N-[4-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 46355928 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[4-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methoxy]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OCc2cc(=O)n3ccccc3n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O3/c26-21-14-18(23-20-8-4-5-13-25(20)21)15-28-19-11-9-17(10-12-19)24-22(27)16-6-2-1-3-7-16/h1-14H,15H2,(H,24,27) |
| InChIKey | NIFKOKWUJGZJHL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |