C25H20ClN3O3 — CID 46357331
1-[(4-chlorophenyl)methyl]-4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]quinoxaline-2,3-dione (PubChem CID 46357331) has the molecular formula C25H20ClN3O3 and a molecular weight of 445.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]quinoxaline-2,3-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 46357331 |
| Molecular Formula | C25H20ClN3O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]quinoxaline-2,3-dione |
| SMILES | O=C(Cn1c(=O)c(=O)n(Cc2ccc(Cl)cc2)c2ccccc21)N1CCc2ccccc21 |
| InChI | InChI=1S/C25H20ClN3O3/c26-19-11-9-17(10-12-19)15-28-21-7-3-4-8-22(21)29(25(32)24(28)31)16-23(30)27-14-13-18-5-1-2-6-20(18)27/h1-12H,13-16H2 |
| InChIKey | IMYUZSXGVFDGTM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|