C21H28N4O3 — CID 46359174
ethyl 1-[1-(1H-benzimidazol-2-yl)piperidine-3-carbonyl]piperidine-4-carboxylate (PubChem CID 46359174) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is ethyl 1-[1-(1H-benzimidazol-2-yl)piperidine-3-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-(1H-benzimidazol-2-yl)piperidine-3-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46359174 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | ethyl 1-[1-(1H-benzimidazol-2-yl)piperidine-3-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2CCCN(c3nc4ccccc4[nH]3)C2)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-2-28-20(27)15-9-12-24(13-10-15)19(26)16-6-5-11-25(14-16)21-22-17-7-3-4-8-18(17)23-21/h3-4,7-8,15-16H,2,5-6,9-14H2,1H3,(H,22,23) |
| InChIKey | KBHOFMBSVOUICW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |