C19H22F2N6O — CID 46359479
3-(3,5-difluorophenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-[1,2]oxazolo[5,4-d]pyrimidin-4-amine (PubChem CID 46359479) has the molecular formula C19H22F2N6O and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-[1,2]oxazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | 3-(3,5-difluorophenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46359479 |
| Molecular Formula | C19H22F2N6O |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CN1CCN(CCCNc2ncnc3onc(-c4cc(F)cc(F)c4)c23)CC1 |
| InChI | InChI=1S/C19H22F2N6O/c1-26-5-7-27(8-6-26)4-2-3-22-18-16-17(25-28-19(16)24-12-23-18)13-9-14(20)11-15(21)10-13/h9-12H,2-8H2,1H3,(H,22,23,24) |
| InChIKey | VGSOSNNZMHCMPI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|