About 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine)
2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine) (PubChem CID 46362) has the molecular formula C8H18N2
and a molecular weight of 142.24 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(2-aminoethyl)cyclobutyl]ethanamine.
Molecular Properties
| Compound Name | 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine) |
| PubChem CID | 46362 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2-[(1S,2S)-2-(2-aminoethyl)cyclobutyl]ethanamine |
| SMILES | C1C[C@H]([C@@H]1CCN)CCN |
| InChI | InChI=1S/C8H18N2/c9-5-3-7-1-2-8(7)4-6-10/h7-8H,1-6,9-10H2/t7-,8-/m0/s1 |
| InChIKey | UPHOTCOTHJGYEE-YUMQZZPRSA-N |
| XLogP | 0.40 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | 81 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine)?
The IUPAC name of 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine) (CID 46362) is 2-[(1S,2S)-2-(2-aminoethyl)cyclobutyl]ethanamine.
What is the SMILES notation for 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine)?
The canonical SMILES for 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine) is C1C[C@H]([C@@H]1CCN)CCN.
What is the InChIKey of 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine)?
The InChIKey is UPHOTCOTHJGYEE-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H18N2/c9-5-3-7-1-2-8(7)4-6-10/h7-8H,1-6,9-10H2/t7-,8-/m0/s1.
What are the key properties of 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine)?
2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine) has a molecular weight of 142.24 g/mol, XLogP of 0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2'-(Cyclobutane-1,2-diyl)di(ethan-1-amine) is sourced from PubChem (CID 46362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).