About [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate
[2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate (PubChem CID 4636234) has the molecular formula C15H9Br2N3O3
and a molecular weight of 439.06 g/mol. Its IUPAC name is [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate.
Molecular Properties
| Compound Name | [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate |
| PubChem CID | 4636234 |
| Molecular Formula | C15H9Br2N3O3 |
| Molecular Weight | 439.06 g/mol |
| Exact Mass | 436.90 |
| IUPAC Name | [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate |
| SMILES | CC(=O)Oc1c(Br)cc(Br)cc1C(=O)n1nnc2ccccc21 |
| InChI | InChI=1S/C15H9Br2N3O3/c1-8(21)23-14-10(6-9(16)7-11(14)17)15(22)20-13-5-3-2-4-12(13)18-19-20/h2-7H,1H3 |
| InChIKey | XOTREOSEYSNCAE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.06 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate?
The IUPAC name of [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate (CID 4636234) is [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate.
What is the SMILES notation for [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate?
The canonical SMILES for [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate is CC(=O)Oc1c(Br)cc(Br)cc1C(=O)n1nnc2ccccc21.
What is the InChIKey of [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate?
The InChIKey is XOTREOSEYSNCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Br2N3O3/c1-8(21)23-14-10(6-9(16)7-11(14)17)15(22)20-13-5-3-2-4-12(13)18-19-20/h2-7H,1H3.
What are the key properties of [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate?
[2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate has a molecular weight of 439.06 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(benzotriazole-1-carbonyl)-4,6-dibromophenyl] acetate is sourced from PubChem (CID 4636234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).