About 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine
6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 46362708) has the molecular formula C17H19N3OS
and a molecular weight of 313.43 g/mol. Its IUPAC name is 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 46362708 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(N(C)c3cc(C)ccc3OC)ncnc2s1 |
| InChI | InChI=1S/C17H19N3OS/c1-5-12-9-13-16(18-10-19-17(13)22-12)20(3)14-8-11(2)6-7-15(14)21-4/h6-10H,5H2,1-4H3 |
| InChIKey | CXNBCZCZBWPNCP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine (CID 46362708) is 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine is CCc1cc2c(N(C)c3cc(C)ccc3OC)ncnc2s1.
What is the InChIKey of 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is CXNBCZCZBWPNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3OS/c1-5-12-9-13-16(18-10-19-17(13)22-12)20(3)14-8-11(2)6-7-15(14)21-4/h6-10H,5H2,1-4H3.
What are the key properties of 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine?
6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 313.43 g/mol, XLogP of 4.34, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N-(2-methoxy-5-methylphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 46362708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).