About 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine
4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine (PubChem CID 46362719) has the molecular formula C20H24N4S
and a molecular weight of 352.51 g/mol. Its IUPAC name is 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine |
| PubChem CID | 46362719 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine |
| SMILES | CCc1cc2c(N3CCN(c4cc(C)ccc4C)CC3)ncnc2s1 |
| InChI | InChI=1S/C20H24N4S/c1-4-16-12-17-19(21-13-22-20(17)25-16)24-9-7-23(8-10-24)18-11-14(2)5-6-15(18)3/h5-6,11-13H,4,7-10H2,1-3H3 |
| InChIKey | IZMURIWLQGYPHT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine?
The IUPAC name of 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine (CID 46362719) is 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine?
The canonical SMILES for 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine is CCc1cc2c(N3CCN(c4cc(C)ccc4C)CC3)ncnc2s1.
What is the InChIKey of 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine?
The InChIKey is IZMURIWLQGYPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4S/c1-4-16-12-17-19(21-13-22-20(17)25-16)24-9-7-23(8-10-24)18-11-14(2)5-6-15(18)3/h5-6,11-13H,4,7-10H2,1-3H3.
What are the key properties of 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine?
4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine has a molecular weight of 352.51 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-ethylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 46362719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).