C20H21N5O5S — CID 46363545
methyl 5-amino-1-[4-[2-(4-sulfamoylphenyl)ethylcarbamoyl]phenyl]pyrazole-4-carboxylate (PubChem CID 46363545) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is methyl 5-amino-1-[4-[2-(4-sulfamoylphenyl)ethylcarbamoyl]phenyl]pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-[4-[2-(4-sulfamoylphenyl)ethylcarbamoyl]phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 46363545 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | methyl 5-amino-1-[4-[2-(4-sulfamoylphenyl)ethylcarbamoyl]phenyl]pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(-c2ccc(C(=O)NCCc3ccc(S(N)(=O)=O)cc3)cc2)c1N |
| InChI | InChI=1S/C20H21N5O5S/c1-30-20(27)17-12-24-25(18(17)21)15-6-4-14(5-7-15)19(26)23-11-10-13-2-8-16(9-3-13)31(22,28)29/h2-9,12H,10-11,21H2,1H3,(H,23,26)(H2,22,28,29) |
| InChIKey | WGVDYAYQMYVRBP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 159.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |