C20H22FN5O3 — CID 46364341
1-[3-(3-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 46364341) has the molecular formula C20H22FN5O3 and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-[3-(3-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(3-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46364341 |
| Molecular Formula | C20H22FN5O3 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-[3-(3-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1CCN(c2ncnc3onc(-c4cccc(F)c4)c23)CC1 |
| InChI | InChI=1S/C20H22FN5O3/c1-28-10-7-22-19(27)13-5-8-26(9-6-13)18-16-17(14-3-2-4-15(21)11-14)25-29-20(16)24-12-23-18/h2-4,11-13H,5-10H2,1H3,(H,22,27) |
| InChIKey | MBWLMORJCXTFCN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|