C17H26FN3O3S — CID 46364516
N-cycloheptyl-2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetamide (PubChem CID 46364516) has the molecular formula C17H26FN3O3S and a molecular weight of 371.48 g/mol. Its IUPAC name is N-cycloheptyl-2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetamide.
| Compound Name | N-cycloheptyl-2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetamide |
|---|---|
| PubChem CID | 46364516 |
| Molecular Formula | C17H26FN3O3S |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-cycloheptyl-2-[N-(dimethylsulfamoyl)-4-fluoroanilino]acetamide |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)NC1CCCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H26FN3O3S/c1-20(2)25(23,24)21(16-11-9-14(18)10-12-16)13-17(22)19-15-7-5-3-4-6-8-15/h9-12,15H,3-8,13H2,1-2H3,(H,19,22) |
| InChIKey | ZBZSQMKAIWGEEV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |