C18H18ClN5O2 — CID 46366222
N-[(4-chlorophenyl)methyl]-2-(1-oxo-7,8,9,10-tetrahydro-[1,2,4]triazino[4,5-b]indazol-2-yl)acetamide (PubChem CID 46366222) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(1-oxo-7,8,9,10-tetrahydro-[1,2,4]triazino[4,5-b]indazol-2-yl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(1-oxo-7,8,9,10-tetrahydro-[1,2,4]triazino[4,5-b]indazol-2-yl)acetamide |
|---|---|
| PubChem CID | 46366222 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(1-oxo-7,8,9,10-tetrahydro-[1,2,4]triazino[4,5-b]indazol-2-yl)acetamide |
| SMILES | O=C(Cn1ncn2nc3c(c2c1=O)CCCC3)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN5O2/c19-13-7-5-12(6-8-13)9-20-16(25)10-23-18(26)17-14-3-1-2-4-15(14)22-24(17)11-21-23/h5-8,11H,1-4,9-10H2,(H,20,25) |
| InChIKey | DPVVRQUWFDMMDM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |