C27H24N2O3 — CID 4636684
[1-[(2-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-ylidene)methyl]naphthalen-2-yl] 4-methylbenzoate (PubChem CID 4636684) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is [1-[(2-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-ylidene)methyl]naphthalen-2-yl] 4-methylbenzoate.
| Compound Name | [1-[(2-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-ylidene)methyl]naphthalen-2-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 4636684 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [1-[(2-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-ylidene)methyl]naphthalen-2-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc3ccccc3c2C=C2C(=O)N=C3CCCCCN23)cc1 |
| InChI | InChI=1S/C27H24N2O3/c1-18-10-12-20(13-11-18)27(31)32-24-15-14-19-7-4-5-8-21(19)22(24)17-23-26(30)28-25-9-3-2-6-16-29(23)25/h4-5,7-8,10-15,17H,2-3,6,9,16H2,1H3 |
| InChIKey | VHLPMCUPRDNLRK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|