C22H20N4O2S2 — CID 46367015
2-(7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 46367015) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-(7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 46367015 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-(7-oxo-6-thiophen-2-yl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1c2ccccc2NC2=C(C(=O)CCC2)C1c1cccs1)Nc1nccs1 |
| InChI | InChI=1S/C22H20N4O2S2/c27-17-8-3-6-15-20(17)21(18-9-4-11-29-18)26(16-7-2-1-5-14(16)24-15)13-19(28)25-22-23-10-12-30-22/h1-2,4-5,7,9-12,21,24H,3,6,8,13H2,(H,23,25,28) |
| InChIKey | KZCOELMAWXJVJJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |