C30H35FN4O6 — CID 4636759
4-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-hydroxypropoxy]-N-[(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 4636759) has the molecular formula C30H35FN4O6 and a molecular weight of 566.63 g/mol. Its IUPAC name is 4-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-hydroxypropoxy]-N-[(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-hydroxypropoxy]-N-[(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4636759 |
| Molecular Formula | C30H35FN4O6 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 4-[3-[4-(4-fluorophenyl)piperazin-1-yl]-2-hydroxypropoxy]-N-[(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(OCC(O)CN3CCN(c4ccc(F)cc4)CC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H35FN4O6/c1-38-27-16-21(17-28(39-2)29(27)40-3)18-32-33-30(37)22-4-10-26(11-5-22)41-20-25(36)19-34-12-14-35(15-13-34)24-8-6-23(31)7-9-24/h4-11,16-18,25,36H,12-15,19-20H2,1-3H3,(H,33,37) |
| InChIKey | GAZACAAROKZSTB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|