About 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one
2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one (PubChem CID 46367653) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one.
Molecular Properties
| Compound Name | 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one |
| PubChem CID | 46367653 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one |
| SMILES | Cc1cccc(N2NC3(CCCCCC3)NC2=O)c1 |
| InChI | InChI=1S/C15H21N3O/c1-12-7-6-8-13(11-12)18-14(19)16-15(17-18)9-4-2-3-5-10-15/h6-8,11,17H,2-5,9-10H2,1H3,(H,16,19) |
| InChIKey | SKVPUWOGHBESHQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one?
The IUPAC name of 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one (CID 46367653) is 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one.
What is the SMILES notation for 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one?
The canonical SMILES for 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one is Cc1cccc(N2NC3(CCCCCC3)NC2=O)c1.
What is the InChIKey of 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one?
The InChIKey is SKVPUWOGHBESHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-12-7-6-8-13(11-12)18-14(19)16-15(17-18)9-4-2-3-5-10-15/h6-8,11,17H,2-5,9-10H2,1H3,(H,16,19).
What are the key properties of 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one?
2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one has a molecular weight of 259.35 g/mol, XLogP of 3.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylphenyl)-1,2,4-triazaspiro[4.6]undecan-3-one is sourced from PubChem (CID 46367653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).