C26H31N5O3 — CID 46367940
[4-(2-methoxyphenyl)piperazin-1-yl]-[1-(3-methoxyquinoxalin-2-yl)piperidin-4-yl]methanone (PubChem CID 46367940) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is [4-(2-methoxyphenyl)piperazin-1-yl]-[1-(3-methoxyquinoxalin-2-yl)piperidin-4-yl]methanone.
| Compound Name | [4-(2-methoxyphenyl)piperazin-1-yl]-[1-(3-methoxyquinoxalin-2-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 46367940 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | [4-(2-methoxyphenyl)piperazin-1-yl]-[1-(3-methoxyquinoxalin-2-yl)piperidin-4-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)C2CCN(c3nc4ccccc4nc3OC)CC2)CC1 |
| InChI | InChI=1S/C26H31N5O3/c1-33-23-10-6-5-9-22(23)29-15-17-31(18-16-29)26(32)19-11-13-30(14-12-19)24-25(34-2)28-21-8-4-3-7-20(21)27-24/h3-10,19H,11-18H2,1-2H3 |
| InChIKey | YWCMQEYBJCEXHN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |