C24H28N4O3 — CID 46367968
N-(4-ethoxyphenyl)-1-(3-ethoxyquinoxalin-2-yl)piperidine-4-carboxamide (PubChem CID 46367968) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1-(3-ethoxyquinoxalin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-1-(3-ethoxyquinoxalin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46367968 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-(4-ethoxyphenyl)-1-(3-ethoxyquinoxalin-2-yl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CCN(c3nc4ccccc4nc3OCC)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-3-30-19-11-9-18(10-12-19)25-23(29)17-13-15-28(16-14-17)22-24(31-4-2)27-21-8-6-5-7-20(21)26-22/h5-12,17H,3-4,13-16H2,1-2H3,(H,25,29) |
| InChIKey | CYSKMIFWSGJKLG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |