C19H18ClN3O4S2 — CID 46369243
N-(3-chloro-4-methoxyphenyl)-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide (PubChem CID 46369243) has the molecular formula C19H18ClN3O4S2 and a molecular weight of 451.96 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 46369243 |
| Molecular Formula | C19H18ClN3O4S2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC3=NC4CS(=O)(=O)CC4S3)cc2)cc1Cl |
| InChI | InChI=1S/C19H18ClN3O4S2/c1-27-16-7-6-13(8-14(16)20)21-18(24)11-2-4-12(5-3-11)22-19-23-15-9-29(25,26)10-17(15)28-19/h2-8,15,17H,9-10H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | DDMADSXYZHEXBF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |