C13H15F3N2O2S — CID 46369379
4-pentyl-6-(trifluoromethyl)-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 46369379) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-pentyl-6-(trifluoromethyl)-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 4-pentyl-6-(trifluoromethyl)-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 46369379 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-pentyl-6-(trifluoromethyl)-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CCCCCN1C=NS(=O)(=O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C13H15F3N2O2S/c1-2-3-4-7-18-9-17-21(19,20)12-6-5-10(8-11(12)18)13(14,15)16/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | NFMIYMRVGKOYMY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|