C20H14FN3O5S — CID 46369426
2-(4-fluorophenyl)-4-[(4-nitrophenyl)methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 46369426) has the molecular formula C20H14FN3O5S and a molecular weight of 427.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[(4-nitrophenyl)methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-(4-fluorophenyl)-4-[(4-nitrophenyl)methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 46369426 |
| Molecular Formula | C20H14FN3O5S |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[(4-nitrophenyl)methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | O=C1N(Cc2ccc([N+](=O)[O-])cc2)c2ccccc2S(=O)(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H14FN3O5S/c21-15-7-11-16(12-8-15)23-20(25)22(13-14-5-9-17(10-6-14)24(26)27)18-3-1-2-4-19(18)30(23,28)29/h1-12H,13H2 |
| InChIKey | XPTYOWLMJBBVRU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|