C28H28Cl2N4O6S — CID 46370664
3-(3,4-dichlorophenyl)-1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-N,N-diethyl-5-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 46370664) has the molecular formula C28H28Cl2N4O6S and a molecular weight of 619.53 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-N,N-diethyl-5-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-N,N-diethyl-5-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46370664 |
| Molecular Formula | C28H28Cl2N4O6S |
| Molecular Weight | 619.53 g/mol |
| Exact Mass | 618.11 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-N,N-diethyl-5-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)c1sc2c(c1C)c(=O)n(-c1ccc(Cl)c(Cl)c1)c(=O)n2CC(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C28H28Cl2N4O6S/c1-6-32(7-2)26(37)24-15(3)23-25(36)34(16-8-10-18(29)19(30)12-16)28(38)33(27(23)41-24)14-22(35)31-20-11-9-17(39-4)13-21(20)40-5/h8-13H,6-7,14H2,1-5H3,(H,31,35) |
| InChIKey | YNIDXLGSAMSYJM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |