C25H31BrCl2N2O4S — CID 46371286
4-[[(4-bromophenyl)sulfonyl-[(2,6-dichlorophenyl)methyl]amino]methyl]-N-(3-methoxypropyl)cyclohexane-1-carboxamide (PubChem CID 46371286) has the molecular formula C25H31BrCl2N2O4S and a molecular weight of 606.41 g/mol. Its IUPAC name is 4-[[(4-bromophenyl)sulfonyl-[(2,6-dichlorophenyl)methyl]amino]methyl]-N-(3-methoxypropyl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[(4-bromophenyl)sulfonyl-[(2,6-dichlorophenyl)methyl]amino]methyl]-N-(3-methoxypropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 46371286 |
| Molecular Formula | C25H31BrCl2N2O4S |
| Molecular Weight | 606.41 g/mol |
| Exact Mass | 604.06 |
| IUPAC Name | 4-[[(4-bromophenyl)sulfonyl-[(2,6-dichlorophenyl)methyl]amino]methyl]-N-(3-methoxypropyl)cyclohexane-1-carboxamide |
| SMILES | COCCCNC(=O)C1CCC(CN(Cc2c(Cl)cccc2Cl)S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C25H31BrCl2N2O4S/c1-34-15-3-14-29-25(31)19-8-6-18(7-9-19)16-30(17-22-23(27)4-2-5-24(22)28)35(32,33)21-12-10-20(26)11-13-21/h2,4-5,10-13,18-19H,3,6-9,14-17H2,1H3,(H,29,31) |
| InChIKey | ULKLZTBABIDDSK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|