C22H24N2O4 — CID 46373032
4-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]-N-(3-propan-2-yloxypropyl)benzamide (PubChem CID 46373032) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]-N-(3-propan-2-yloxypropyl)benzamide.
| Compound Name | 4-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]-N-(3-propan-2-yloxypropyl)benzamide |
|---|---|
| PubChem CID | 46373032 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[(Z)-(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]-N-(3-propan-2-yloxypropyl)benzamide |
| SMILES | CC(C)OCCCNC(=O)c1ccc(/C=C2\Oc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-15(2)27-13-5-12-23-21(25)17-10-8-16(9-11-17)14-20-22(26)24-18-6-3-4-7-19(18)28-20/h3-4,6-11,14-15H,5,12-13H2,1-2H3,(H,23,25)(H,24,26)/b20-14- |
| InChIKey | JKDWILLGROKPSL-ZHZULCJRSA-N |
| XLogP | 3.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|