C28H36ClN3O2S — CID 4637317
N-(1-benzylpiperidin-4-yl)-3-(2-chlorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide (PubChem CID 4637317) has the molecular formula C28H36ClN3O2S and a molecular weight of 514.14 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-(2-chlorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-(2-chlorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 4637317 |
| Molecular Formula | C28H36ClN3O2S |
| Molecular Weight | 514.14 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-(2-chlorobenzoyl)-2-pentyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCC1SCC(C(=O)NC2CCN(Cc3ccccc3)CC2)N1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C28H36ClN3O2S/c1-2-3-5-14-26-32(28(34)23-12-8-9-13-24(23)29)25(20-35-26)27(33)30-22-15-17-31(18-16-22)19-21-10-6-4-7-11-21/h4,6-13,22,25-26H,2-3,5,14-20H2,1H3,(H,30,33) |
| InChIKey | KGLVCWPWWHGNIQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.14 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|