C30H22Cl2N2O2 — CID 4637481
1-(10-acetyl-3,8-dichloro-4b,9b-diphenylindolo[3,2-b]indol-5-yl)ethanone (PubChem CID 4637481) has the molecular formula C30H22Cl2N2O2 and a molecular weight of 513.42 g/mol. Its IUPAC name is 1-(10-acetyl-3,8-dichloro-4b,9b-diphenylindolo[3,2-b]indol-5-yl)ethanone.
| Compound Name | 1-(10-acetyl-3,8-dichloro-4b,9b-diphenylindolo[3,2-b]indol-5-yl)ethanone |
|---|---|
| PubChem CID | 4637481 |
| Molecular Formula | C30H22Cl2N2O2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 1-(10-acetyl-3,8-dichloro-4b,9b-diphenylindolo[3,2-b]indol-5-yl)ethanone |
| SMILES | CC(=O)N1c2ccc(Cl)cc2C2(c3ccccc3)N(C(C)=O)c3ccc(Cl)cc3C12c1ccccc1 |
| InChI | InChI=1S/C30H22Cl2N2O2/c1-19(35)33-27-15-13-23(31)17-25(27)30(22-11-7-4-8-12-22)29(33,21-9-5-3-6-10-21)26-18-24(32)14-16-28(26)34(30)20(2)36/h3-18H,1-2H3 |
| InChIKey | IUBMUKQUDADUGR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |