About 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one
6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 46377645) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 46377645 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1nc2scc(C)n2c(=O)c1N |
| InChI | InChI=1S/C8H9N3OS/c1-4-3-13-8-10-5(2)6(9)7(12)11(4)8/h3H,9H2,1-2H3 |
| InChIKey | JIVTUBGLPFOARN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 46377645) is 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is Cc1nc2scc(C)n2c(=O)c1N.
What is the InChIKey of 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is JIVTUBGLPFOARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-4-3-13-8-10-5(2)6(9)7(12)11(4)8/h3H,9H2,1-2H3.
What are the key properties of 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 195.25 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 46377645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).