C22H26N4O2S — CID 4637766
N-[(2-methoxyphenyl)methyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbothioamide (PubChem CID 4637766) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 4637766 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbothioamide |
| SMILES | COc1ccccc1CNC(=S)N1CCC2(CC1)C(=O)NCN2c1ccccc1 |
| InChI | InChI=1S/C22H26N4O2S/c1-28-19-10-6-5-7-17(19)15-23-21(29)25-13-11-22(12-14-25)20(27)24-16-26(22)18-8-3-2-4-9-18/h2-10H,11-16H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | JFZNBHMBESWSGZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|