C26H36N4O2 — CID 46377822
N-cycloheptyl-2-[1-(3-methyl-1-phenylpyrazole-4-carbonyl)piperidin-4-yl]propanamide (PubChem CID 46377822) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-cycloheptyl-2-[1-(3-methyl-1-phenylpyrazole-4-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | N-cycloheptyl-2-[1-(3-methyl-1-phenylpyrazole-4-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 46377822 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | N-cycloheptyl-2-[1-(3-methyl-1-phenylpyrazole-4-carbonyl)piperidin-4-yl]propanamide |
| SMILES | Cc1nn(-c2ccccc2)cc1C(=O)N1CCC(C(C)C(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C26H36N4O2/c1-19(25(31)27-22-10-6-3-4-7-11-22)21-14-16-29(17-15-21)26(32)24-18-30(28-20(24)2)23-12-8-5-9-13-23/h5,8-9,12-13,18-19,21-22H,3-4,6-7,10-11,14-17H2,1-2H3,(H,27,31) |
| InChIKey | LUWUZUJHEDTCKT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |