C24H25FN2O3S — CID 46379091
ethyl 1-[2-[2-(3-fluorophenyl)sulfanyl-1H-indol-3-yl]acetyl]piperidine-3-carboxylate (PubChem CID 46379091) has the molecular formula C24H25FN2O3S and a molecular weight of 440.54 g/mol. Its IUPAC name is ethyl 1-[2-[2-(3-fluorophenyl)sulfanyl-1H-indol-3-yl]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[2-(3-fluorophenyl)sulfanyl-1H-indol-3-yl]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46379091 |
| Molecular Formula | C24H25FN2O3S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | ethyl 1-[2-[2-(3-fluorophenyl)sulfanyl-1H-indol-3-yl]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)Cc2c(Sc3cccc(F)c3)[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C24H25FN2O3S/c1-2-30-24(29)16-7-6-12-27(15-16)22(28)14-20-19-10-3-4-11-21(19)26-23(20)31-18-9-5-8-17(25)13-18/h3-5,8-11,13,16,26H,2,6-7,12,14-15H2,1H3 |
| InChIKey | AEERDVIMGIKAAV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |