About 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide
4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide (PubChem CID 46379836) has the molecular formula C18H28N4O4S2
and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide |
| PubChem CID | 46379836 |
| Molecular Formula | C18H28N4O4S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)N2CCC(C(=O)NC3CC3)CC2)s1 |
| InChI | InChI=1S/C18H28N4O4S2/c1-3-22(4-2)28(25,26)16-8-7-15(27-16)20-18(24)21-11-9-13(10-12-21)17(23)19-14-5-6-14/h7-8,13-14H,3-6,9-12H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | RJISDJBVODXBPN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide?
The IUPAC name of 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide (CID 46379836) is 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide.
What is the SMILES notation for 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide?
The canonical SMILES for 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide is CCN(CC)S(=O)(=O)c1ccc(NC(=O)N2CCC(C(=O)NC3CC3)CC2)s1.
What is the InChIKey of 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide?
The InChIKey is RJISDJBVODXBPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O4S2/c1-3-22(4-2)28(25,26)16-8-7-15(27-16)20-18(24)21-11-9-13(10-12-21)17(23)19-14-5-6-14/h7-8,13-14H,3-6,9-12H2,1-2H3,(H,19,23)(H,20,24).
What are the key properties of 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide?
4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide has a molecular weight of 428.58 g/mol, XLogP of 2.30, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-cyclopropyl-1-N-[5-(diethylsulfamoyl)thiophen-2-yl]piperidine-1,4-dicarboxamide is sourced from PubChem (CID 46379836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).