C24H25N5O2S2 — CID 46380162
N-[4-[(6-ethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 46380162) has the molecular formula C24H25N5O2S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-[4-[(6-ethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-[4-[(6-ethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 46380162 |
| Molecular Formula | C24H25N5O2S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | N-[4-[(6-ethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | CCc1c(C)nc2ncnn2c1Sc1ccc(NS(=O)(=O)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C24H25N5O2S2/c1-3-22-16(2)27-24-25-15-26-29(24)23(22)32-20-11-9-19(10-12-20)28-33(30,31)21-13-8-17-6-4-5-7-18(17)14-21/h8-15,28H,3-7H2,1-2H3 |
| InChIKey | YGTKGJSRTMJSLI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |