About N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide
N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide (PubChem CID 46381307) has the molecular formula C17H26N4O3
and a molecular weight of 334.42 g/mol. Its IUPAC name is N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide |
| PubChem CID | 46381307 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide |
| SMILES | Cn1c(N2CCC(C(=O)NC3CCCC3)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C17H26N4O3/c1-19-14(11-15(22)20(2)17(19)24)21-9-7-12(8-10-21)16(23)18-13-5-3-4-6-13/h11-13H,3-10H2,1-2H3,(H,18,23) |
| InChIKey | AGGIHRCRZDBXJC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide?
The IUPAC name of N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide (CID 46381307) is N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide.
What is the SMILES notation for N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide?
The canonical SMILES for N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide is Cn1c(N2CCC(C(=O)NC3CCCC3)CC2)cc(=O)n(C)c1=O.
What is the InChIKey of N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide?
The InChIKey is AGGIHRCRZDBXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O3/c1-19-14(11-15(22)20(2)17(19)24)21-9-7-12(8-10-21)16(23)18-13-5-3-4-6-13/h11-13H,3-10H2,1-2H3,(H,18,23).
What are the key properties of N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide?
N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide has a molecular weight of 334.42 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperidine-4-carboxamide is sourced from PubChem (CID 46381307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).