C16H20N2O2 — CID 46381950
N-(2-methoxyethyl)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide (PubChem CID 46381950) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 46381950 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(2-methoxyethyl)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| SMILES | COCCNC(=O)C1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C16H20N2O2/c1-20-10-9-17-16(19)13-7-4-6-12-11-5-2-3-8-14(11)18-15(12)13/h2-3,5,8,13,18H,4,6-7,9-10H2,1H3,(H,17,19) |
| InChIKey | AFZAFHKDVNPQPA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|