C26H26N4O3 — CID 46382279
ethyl 2-[4-[[4-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]carbamoylamino]phenyl]acetate (PubChem CID 46382279) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is ethyl 2-[4-[[4-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]carbamoylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[4-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 46382279 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | ethyl 2-[4-[[4-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]carbamoylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)Nc2ccc(CCc3nc4ccccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O3/c1-2-33-25(31)17-19-9-14-21(15-10-19)28-26(32)27-20-12-7-18(8-13-20)11-16-24-29-22-5-3-4-6-23(22)30-24/h3-10,12-15H,2,11,16-17H2,1H3,(H,29,30)(H2,27,28,32) |
| InChIKey | ISXHAQXTOBSWTN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |