C27H30N4O4 — CID 46382319
1-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 46382319) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 46382319 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | CCn1c(CCc2ccc(NC(=O)Nc3cc(OC)c(OC)c(OC)c3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C27H30N4O4/c1-5-31-22-9-7-6-8-21(22)30-25(31)15-12-18-10-13-19(14-11-18)28-27(32)29-20-16-23(33-2)26(35-4)24(17-20)34-3/h6-11,13-14,16-17H,5,12,15H2,1-4H3,(H2,28,29,32) |
| InChIKey | BODHVMZIORVMSR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |