C15H13ClN4O3S2 — CID 46382418
1-(2-chlorophenyl)-3-[2-(methanesulfonamido)-1,3-benzothiazol-6-yl]urea (PubChem CID 46382418) has the molecular formula C15H13ClN4O3S2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-(methanesulfonamido)-1,3-benzothiazol-6-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-(methanesulfonamido)-1,3-benzothiazol-6-yl]urea |
|---|---|
| PubChem CID | 46382418 |
| Molecular Formula | C15H13ClN4O3S2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-(methanesulfonamido)-1,3-benzothiazol-6-yl]urea |
| SMILES | CS(=O)(=O)Nc1nc2ccc(NC(=O)Nc3ccccc3Cl)cc2s1 |
| InChI | InChI=1S/C15H13ClN4O3S2/c1-25(22,23)20-15-19-12-7-6-9(8-13(12)24-15)17-14(21)18-11-5-3-2-4-10(11)16/h2-8H,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | KRMJBGKHEWXODJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |