About 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline
1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline (PubChem CID 46382906) has the molecular formula C18H22N2O2S
and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline.
Molecular Properties
| Compound Name | 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline |
| PubChem CID | 46382906 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H22N2O2S/c1-3-6-15-9-11-16(12-10-15)23(21,22)20-14-13-19(2)17-7-4-5-8-18(17)20/h4-5,7-12H,3,6,13-14H2,1-2H3 |
| InChIKey | IVARWMYSMATKMG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline?
The IUPAC name of 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline (CID 46382906) is 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline.
What is the SMILES notation for 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline?
The canonical SMILES for 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline is CCCc1ccc(S(=O)(=O)N2CCN(C)c3ccccc32)cc1.
What is the InChIKey of 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline?
The InChIKey is IVARWMYSMATKMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2S/c1-3-6-15-9-11-16(12-10-15)23(21,22)20-14-13-19(2)17-7-4-5-8-18(17)20/h4-5,7-12H,3,6,13-14H2,1-2H3.
What are the key properties of 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline?
1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline has a molecular weight of 330.45 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(4-propylphenyl)sulfonyl-2,3-dihydroquinoxaline is sourced from PubChem (CID 46382906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).