C16H17ClN2O3S — CID 46382919
1-(5-chloro-2-methoxyphenyl)sulfonyl-4-methyl-2,3-dihydroquinoxaline (PubChem CID 46382919) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-methyl-2,3-dihydroquinoxaline.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-methyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 46382919 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-methyl-2,3-dihydroquinoxaline |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-18-9-10-19(14-6-4-3-5-13(14)18)23(20,21)16-11-12(17)7-8-15(16)22-2/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | PYQQYFDRKYECET-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |