C14H19N3O2 — CID 46383476
1-[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-ethylurea (PubChem CID 46383476) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-ethylurea.
| Compound Name | 1-[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 46383476 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)NC(C)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H19N3O2/c1-3-15-14(19)16-10(2)13(18)17-9-8-11-6-4-5-7-12(11)17/h4-7,10H,3,8-9H2,1-2H3,(H2,15,16,19) |
| InChIKey | AXOZWBOJQKPRBB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |